| Cas No.: | 1857340-77-2 |
| Chemical Name: | 4A3-SC7 |
| Synonyms: | 4A3SC7, 4A3 SC7 |
| SMILES: | O=C(CCN(CCCN(CCCN(CCC(OCCOC(C(CSCCCCCCC)C)=O)=O)CCC(OCCOC(C(CSCCCCCCC)C)=O)=O)C)CCC(OCCOC(C(CSCCCCCCC)C)=O)=O)OCCOC(C(CSCCCCCCC)C)=O |
| Formula: | C71H131N3O16S4 |
| M.Wt: | 1411.07 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Dual SORT LNPs for multi-organ base editing-June 2025 Nature Biotechnology-Minjeong Kim1, Daniel J. Siegwart .etl |
| Description: | Dual SORT LNPs for multi-organ base editing-June 2025 Nature Biotechnology-Minjeong Kim1, Daniel J. Siegwart .etl |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
