| Cas No.: | 1263293-37-3 |
| Chemical Name: | Onvansertib fumarate |
| Synonyms: | NMS-P937 , NMS P937 , NMSP937 |
| SMILES: | O=C(C1=NN(CCO)C2=C1CCC3=CN=C(NC4=CC(N5CCN(C)CC5)=CC=C4OC(F)(F)F)N=C23)N.O=C(O)/C=C/C(O)=O |
| Formula: | C28H31F3N8O7 |
| M.Wt: | 648.6 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
