| Cas No.: | 62858-30-4 |
| Chemical Name: | m7G(5')ppp(5')(2'OMeA)pG |
| Synonyms: | HY-145974;CS-0459559;m7GpppAmpG;62858-30-4;DA-65181 |
| SMILES: | P(=O)(O)(OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3C(NC(N)=NC2=3)=O)O1)O)O)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)([O-])OC[C@@H]2[C@H]([C@H]([C@H]([N+]3=CN(C)C4C(NC(N)=NC3=4)=O)O2)O)O)O[C@H]([C@@H]1OC)N1C=NC2C(N)=NC=NC1=2 |
| Formula: | C32H43N15O24P4 |
| M.Wt: | 1145.66 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
