To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1637413-82-1 |
| Chemical Name: | THA8 |
| Synonyms: | THA8-acid ;THA8 acid |
| SMILES: | O1[C@H]([C@@H]([C@H]([C@H]([C@H]1COC(C)=O)OC(C)=O)OC(C)=O)NC(C)=O)OCCCCCCNC(CCOCC(COCCC(NCCCCCCO[C@H]1[C@@H]([C@H]([C@H]([C@@H](COC(C)=O)O1)OC(C)=O)OC(C)=O)NC(C)=O)=O)(COCCC(NCCCCCCO[C@H]1[C@@H]([C@H]([C@H]([C@@H](COC(C)=O)O1)OC(C)=O)OC(C)=O)NC(C)=O)=O)NC(CCCC(=O)O)=O)=O |
| Formula: | C78H125N7O36 |
| M.Wt: | 1736.87 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
