| Cas No.: | 192203-60-4 |
| Chemical Name: | L-Glutamic acid, N-[[(4-methoxyphenyl)thio]carbonyl]- |
| Synonyms: | L-Glutamic acid, N-[[(4-methoxyphenyl)thio]carbonyl]-;N-[[(4-Methoxyphenyl)thio]carbonyl]-L-glutamic acid;(2S)-2-[(4-methoxyphenyl)sulfanylcarbonylamino]pentanedioic acid;Carboxypeptidase G2 (CPG2) Inhibitor;CPG2 Inhibitor;CHEBI:391781;CHEMBL175115;CS-0824;HY-70003;Carboxypeptidase G2 Inhibitor |
| SMILES: | O=C(SC(C=C1)=CC=C1OC)N[C@@H](CCC(O)=O)C(O)=O |
| Formula: | C13H15NO6S |
| M.Wt: | 313.3263 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Carboxypeptidase G2 (CPG2) Inhibitor is a novel Carboxypeptidase G2 (CPG2) Inhibitor, Antitumor agents. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
