| Cas No.: | 151358-48-4 |
| Chemical Name: | DIM-C-pPhCO2Me |
| Synonyms: | DIM-C-pPhCO2Me;J3.596.813J;p-(Di(1H-indole-3-yl)methyl)benzoic acid methyl ester |
| SMILES: | O(C([H])([H])[H])C(C1C([H])=C([H])C(=C([H])C=1[H])C([H])(C1=C([H])N([H])C2=C([H])C([H])=C([H])C([H])=C12)C1=C([H])N([H])C2=C([H])C([H])=C([H])C([H])=C12)=O |
| Formula: | C25H20N2O2 |
| M.Wt: | 380.4385 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | DIM-C-pPhCO2Me is a nuclear receptor 4A1 (NR4A1) antagonist[1]. Antineoplastic activity[1]. |
| References: | [1]. Hedrick E, et al. Nuclear Receptor 4A1 (NR4A1) as a Drug Target for Renal Cell Adenocarcinoma. PLoS One. 2015 Jun 2;10(6):e0128308 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
