| Cas No.: | 205309-81-5 |
| Chemical Name: | DL-TBOA |
| Synonyms: | D-Aspartic acid, 3-(phenylmethoxy)-, (3R)-rel-;DL-TBOA;DL-threo-β-Benzyloxyasparticacid;2-amino-3-phenylmethoxybutanedioic acid;2-Amino-3-(benzyloxy)succinic acid;(2S,3S)-2-Amino-3-benzyloxy-succinic acid;threo-beta-benzyloxyaspartic acid;D,L-threo-beta-benzyloxyaspartate;HMS3267D15;BDBM50247191;DL-2-amino-3-(benzyloxy)succinic acid;Q27166729 |
| SMILES: | O(CC1C=CC=CC=1)C(C(=O)O)C(C(=O)O)N |
| Formula: | C11H13NO5 |
| M.Wt: | 239.224623441696 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
