To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 14663-23-1 |
| SMILES: | [Na+].O=[N+](C1=CC=C(C2=CC=C(/C=N/N3CC(=O)[N-]C3=O)O2)C=C1)[O-] |
| Formula: | C14H9N4NaO5 |
| M.Wt: | 336.23 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Dantrolene sodium is a inhibitor of calcium channel proteins, inhibiting the release of Ca2+ from the sarcoplasm. Dantrolene sodium is a skeletal muscle relaxant which acts by blocking muscle contraction beyond the neuromuscular junction. |
