| Cas No.: | 960539-70-2 |
| Chemical Name: | Daprodustat |
| Synonyms: | Daprodustat;daprodustat,GSK1278863;GSK1278863;JVR38ZM64B;N-((1,3-Dicyclohexylhexahydro-2,4,6-trioxopyrimidin-5-yl)carbonyl)glycine;(1,3-dicyclohexyl-2,4,6-trioxohexahydropyrimidine-5-carbonyl)glycine;2-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]acetic acid;Daprodustat [USAN:INN];Daprodustat (GSK1278863);Duvroq (TN);GSK 1278863;Daprodustat; GSK1278863;Daprodustat (JAN/USAN/INN);GTPL8455;BCP16766;s8171;2-[(1,3- |
| SMILES: | O=C1N(C(C([H])(C(N([H])C([H])([H])C(=O)O[H])=O)C(N1C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H])=O)=O)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] |
| Formula: | C19H27N3O6 |
| M.Wt: | 393.4342 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Daprodustat (GSK1278863) is an orally active hypoxia-inducible factor prolyl hydroxylase inhibitor being developed for the treatment of anemia associated with chronic kidney disease. |
| In Vitro: | GSK1278863 is an orally administered small-molecule PHI, and stimulates endogenous EPO synthesis and induce effective erythropoiesis[1]. GSK1278863 has been shown to increase erythropoietin levels, leading to increases in hemoglobin, hematocrit and red blood cell numbers[2]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
