| Cas No.: | 74226-22-5 |
| Chemical Name: | 4-(2-(1H-Imidazol-1-yl)ethoxy)benzoic acid hydrochloride |
| Synonyms: | Dazoxiben hydrochloride; Dazoxiben hydrochloride, Dazoxiben HCl; Dazoxiben hydrochloride, UK-37248; UK37248; UK-37,248-01. |
| SMILES: | Cl.O=C(O)C1=CC=C(OCCN2C=CN=C2)C=C1 |
| Formula: | C12H13ClN2O3 |
| M.Wt: | 268.697 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
