To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2624-44-4 |
| SMILES: | CCNCC.OC1C=CC(O)=C(S(=O)(O)=O)C=1 |
| Formula: | C10H17NO5S |
| M.Wt: | 263.31 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Ethamsylate is a haemostatic drug, also inhibits biosynthesis and action of those prostaglandins. |
