| Cas No.: | 54048-10-1 |
| Synonyms: | Implanon;Nexplanon;3-Oxodesogestrel;3-keto-Desogestrel |
| SMILES: | CC[C@]([C@]1(O)C#C)(C2)[C@](CC1)([H])[C@@](CCC3=CC4=O)([H])[C@]([C@@]3([H])CC4)([H])C2=C |
| Formula: | C22H28O2 |
| M.Wt: | 324.4565 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Etonogestrel is a steroidal progestin used in hormonal contraceptives. Etonogestrel is used as a female contraceptive. Etonogestrel is a progestin or a synthetic form of the naturally occurring female sex hormone, progesterone. Etonogestrel tricks the body processes into thinking that ovulation has already occurred, by maintaining high levels of the synthetic progesterone. This prevents the release of eggs from the ovaries. Etonogestrel binds to the progesterone and estrogen receptors. Target cells include the female reproductive tract, the mammary gland, the hypothalamus, and the pituitary. Once bound to the receptor, progestins like etonogestrel will slow the frequency of release of gonadotropin releasing hormone (GnRH) from the hypothalamus and blunt the pre-ovulatory LH (luteinizing hormone) surge. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
