| Cas No.: | 1099829-15-8 |
| Chemical Name: | Folate-PEG2-amine |
| Synonyms: | Folate-PEG2-amine;(S)-2-(4-((2-amino-4-hydroxypteridin-6-yl)methylamino)benzamido)-5-(2-(2-(2-aminoethoxy)ethoxy)ethylamino)-5-oxopentanoic acid |
| SMILES: | O(C([H])([H])C([H])([H])OC([H])([H])C([H])([H])N([H])[H])C([H])([H])C([H])([H])N([H])C(C([H])([H])C([H])([H])[C@@]([H])(C(=O)O[H])N([H])C(C1C([H])=C([H])C(=C([H])C=1[H])N([H])C([H])([H])C1=C([H])N=C2C(C(N([H])C(N([H])[H])=N2)=O)=N1)=O)=O |
| Formula: | C25H33N9O7 |
| M.Wt: | 571.5856 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
