To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 64048-12-0 |
| Synonyms: | NSC 75503;GANT58;GANT-58;NSC-75503 |
| SMILES: | C(C(C1=CC=NC=C1)=C2C3=CC=NC=C3)(C4=CC=NC=C4)=C(S2)C5=CC=NC=C5 |
| Formula: | C24H16N4S |
| M.Wt: | 392.4756 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GANT 58 is a novel and potent Gli antagonist that inhibits GLI1-induced transcription (IC50 = 5 uM). GANT 58 inhibits the hedgehog (Hh) signaling pathway downstream of SMO and SUFU causing GLI1 nuclear accumulation. Displays antiproliferative and antitumor activity in vivo. |