| Cas No.: | 1539314-06-1 |
| Chemical Name: | GSK-2881078 |
| Synonyms: | GSK-2881078;GSK2881078;BCP20210;GSK 2881078;1-(1-methylsulfonylpropan-2-yl)-4-(trifluoromethyl)indole-5-carbonitrile |
| SMILES: | S(C([H])([H])[H])(C([H])([H])C([H])(C([H])([H])[H])N1C([H])=C([H])C2C(C(F)(F)F)=C(C#N)C([H])=C([H])C1=2)(=O)=O |
| Formula: | C14H13F3N2O2S |
| M.Wt: | 330.3254 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GSK 2881078 is a selective androgen receptor modulator potentially for the treatment of cachexia.GSK 2881078 is a selective androgen receptor modulator (SARM) that is being evaluated for effects on muscle growth and strength in subjects with muscle wasting to improve their physical function. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
