| Cas No.: | 5001-32-1 |
| Chemical Name: | Guanoclor |
| Synonyms: | Hydrazinecarboximidamide,2-[2-(2,6-dichlorophenoxy)ethyl]-;Guanochlorine;guanoclor;Guanochlor;Vatensol;Guanoclor sulfate;2-[2-(2,6-Dichlorophenoxy)ethyl]hydrazinecarboximidamide;[[2-(2,6-Dichlorophenoxy)ethyl]amino]guanidine;Compound 1029;M4HBT852YO;Guanocloro;Guanoclorum;NSC92354;Guanoclor [INN:BAN];Guanoclorum [INN-Latin];Guanocloro [INN-Spanish];C9H12Cl2N4O;guanoclorsulfat;Hydrazinecarboximidamide, 2-[2-(2,6-dichlorophenoxy)ethyl]-, sulfate (2:1);Guanoclor sulfate(USAN) |
| SMILES: | ClC1C([H])=C([H])C([H])=C(C=1OC([H])([H])C([H])([H])N([H])/N=C(\N([H])[H])/N([H])[H])Cl |
| Formula: | C9H12Cl2N4O |
| M.Wt: | 263.1238 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
