| Cas No.: | 220810-26-4 |
| Chemical Name: | Histrelin acetate |
| Synonyms: | Histrelin Acetate;(Des-Gly¹⁰,D-His(Bzl)⁶,Pro-NHEt⁹)-LHRH;Vantas;Supprelin;Histrelin (acetate);Histrelin Acetate(Vantas)/;ABP000581;8148AH;C66H86N18O12.C2H4O2;767H828 |
| SMILES: | O=C([C@H](CCC/N=C(/N)\N)NC([C@H](CC(C)C)NC([C@@H](CC1=CN(CC2C=CC=CC=2)C=N1)NC([C@H](CC1C=CC(=CC=1)O)NC([C@H](CO)NC([C@H](CC1=CNC2=CC=CC=C12)NC([C@H](CC1=CN=CN1)NC([C@@H]1CCC(N1)=O)=O)=O)=O)=O)=O)=O)=O)N1CCC[C@H]1C(NCC)=O.OC(C)=O |
| Formula: | C66H86N18O12.NC2H4O2 |
| M.Wt: | 1383.55 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Histrelin is a synthetic gonadotropin-releasing hormone (GNRH) agonist that binds to the GNRH receptor (GNRHR; Ki = 0.2 nM in CHO cells expressing the human receptor). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
