| Cas No.: | 1388841-50-6 |
| Chemical Name: | KPT 251 |
| Synonyms: | KPT 251;KPT 251, >=98%;2-[(Z)-2-{3-[3,5-Bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}vinyl]-1,3,4-oxadiazole;KPT251;AOB6639;SCHEMBL11318201; AOB6639;myeloid leukemia,Apoptosis,KPT 251,Chromosomal Maintenance 1,CRM1,inhibit,Exportin 1,KPT-251,melanoma,XPO1,A375,Inhibitor,antileukemic activity;KPT-251 |
| SMILES: | O1C=NN=C1/C=C\N1C=NC(C2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)=N1 |
| Formula: | C14H7F6N5O |
| M.Wt: | 375.230 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | KPT-251 is a selective inhibitor of nuclear export (SINE). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
