| Cas No.: | 2245072-20-0 |
| Chemical Name: | (S)-2-(Dimethylcarbamothioyl)-N-(2-methyl-4-(1-methyl1,4,5,10-tetrahydrobenzo[b]pyrazolo[3,4-e][1,4]diazepine-5- carbonyl)benzyl)pyrrolidine-1-carboxamide |
| Synonyms: | LIT001 |
| SMILES: | N(C(NCC1=CC=C(C(N2CC3C=NN(C)C=3NC3=CC=CC=C23)=O)C=C1C)=O)1CCC[C@@H]1C(=S)N(C)C |
| Formula: | C28H33N7O2S |
| M.Wt: | 531.679 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LIT-001 (LIT001) is the first nonpeptide Oxytocin receptor (OT-R) agonist with EC50 of 55 nM, Emax=96%; efficiently relieved social interaction deficits in Oprm1−/− mice, a mouse model of autism. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
