| Cas No.: | 2207541-30-6 |
| Chemical Name: | Lenalidomide-I |
| Synonyms: | Lenalidomide-I;AT18712;3-(7-iodo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;C1=CC2=C(C(=C1)I)CN(C2=O)C1C(=O)NC(=O)CC1;3-(4-IODO-1-OXOISOINDOLIN-2-YL)PIPERIDINE-2,6-DIONE |
| SMILES: | IC1=C([H])C([H])=C([H])C2C(N(C([H])([H])C=21)C1([H])C(N([H])C(C([H])([H])C1([H])[H])=O)=O)=O |
| Formula: | C13H11In2O3 |
| M.Wt: | 370.1425 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
