| Cas No.: | 103476-89-7 |
| Chemical Name: | (S)-2-acetamido-N-((S)-1-amino-4-methyl-1-oxopentan-2-yl)-N-((S)-5-guanidino-1-oxopentan-2-yl)-4-methylpentanamide hemisulfate |
| Synonyms: | Leupeptin hemisulfate anhydrous; NK-381; NK 381; NK381; |
| SMILES: | OS(=O)(O)=O.N/C(=N/CCCC(NC(C(NC(C(NC(=O)C)CC(C)C)=O)CC(C)C)=O)C=O)/N.N/C(=N/CCCC(NC(C(NC(C(NC(=O)C)CC(C)C)=O)CC(C)C)=O)C=O)/N |
| Formula: | C40H78N12O12S |
| M.Wt: | 951.19 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
