| Cas No.: | 55-06-1 |
| Chemical Name: | sodium (S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoate |
| Synonyms: | Liothyronine; Triiodothyronine; 3,3',5-Triiodo-L-thyronine; Liothyronin; Tresitope; 3,5,3'-triiodothyronine; Cytomel; Tertroxin |
| SMILES: | O=C([O-])[C@@H](N)CC1=CC(I)=C(OC2=CC=C(O)C(I)=C2)C(I)=C1.[Na+] |
| Formula: | C15H11I3NNaO4 |
| M.Wt: | 672.96 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | 3,3',5-Triiodo-L-thyronine sodium is an active form of thyroid hormone, which binds to β1 thyroid hormone receptor (TRβ1), and activates its activity. |
| In Vitro: | 3,3',5-Triiodo-L-thyronine (T3, 100 nM) stimulates the proliferation of hepatocarcinema cells in which TRβ1 is overexpressed[1]. 3,3',5-Triiodo-L-thyronine binds to human β1 thyroid hormone receptor (hTRβ1), and change its conformation. 3,3',5-Triiodo-L-thyronine promotes growth, induces differentiation and regualtes metabolic effects[2]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
