| Cas No.: | 61036-62-2 |
| Chemical Name: | Teicoplanin |
| Synonyms: | Teicoplanin;8327a;antibiotic8327a;teichomycin;Teocoplanin;Telicoplanin;TEICOPLANIN, JP;TeicoplaninSodium;Teicoplanin Complex;Antibiotic MDL-507;MDL-507;Tagocid;TEIC;Teicoplanin(sterile,non-sterile) |
| SMILES: | C1(O)=CC=C2[C@@H](N)C(N[C@@H]3CC4C=C(Cl)C(OC5C(O[C@@H]6O[C@H](CO)[C@@H](O)[C@@H]([C@H]6NC(CCCCCCCCC)=O)O)=C6OC7C=CC(=CC=7Cl)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7NC(C)=O)[C@@H]7NC(=O)[C@@H](C8C=C(C9=C(C=C(O)C=C9OC9[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O9)[C@@H](C(=O)O)NC7=O)C(O)=CC=8)NC(=O)[C@@H](C(C=5)=C6)NC(=O)[C@H](C5C=C(O)C=C(OC1=C2)C=5)NC3=O)=CC=4)=O |
| Formula: | C88H97Cl2N9O33 |
| M.Wt: | 1879.65830397606 |
| Purity: | >99% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Teicoplanin is a semisynthetic glycopeptide antibiotic used in the prophylaxis and treatment of serious infections caused by Gram-positive bacteria, including Methicillin-resistant Staphylococcus aureus and Enterococcus faecalis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
