| Cas No.: | 1016535-83-3 |
| Chemical Name: | 2-(4-((4-Fluorobenzyl)oxy)phenyl)acetonitrile |
| Synonyms: | 2-(4-(4-methoxybenzyloxy)phenyl)acetonitrile;Oct3 and 4-inducer-1;MDK35833(Oct3/4-inducer-1);2-(4-((4-fluorobenzyl)oxy)phenyl)acetonitrile;2-[4-[(4-fluorophenyl)methoxy]phenyl]acetonitrile;2-{4-[(4-fluorophenyl)methoxy]phenyl}acetonitrile;MDK35833Oct3/4-inducer-1;BCP24154;2-[4-(4-Fluorobenzyloxy)phenyl]acetonitrile;J3.583.555E;Oct3/4-inducer-1 |
| SMILES: | FC1C([H])=C([H])C(=C([H])C=1[H])C([H])([H])OC1C([H])=C([H])C(C([H])([H])C#N)=C([H])C=1[H] |
| Formula: | C15NOFH12 |
| M.Wt: | 241.2603 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Oct3/4-inducer-1 (compound 2) is a potent Oct3/4 inducer. Oct3/4-inducer-1 promotes expression and stabilization of Oct3/4, and enhances its transcriptional activity in diverse human somatic cells[1]. |
| References: | [1]. Cheng X, et al. Identification of 2-[4-[(4-Methoxyphenyl)methoxy]-phenyl]acetonitrile and Derivatives as Potent Oct3/4 Inducers. J Med Chem. 2015;58(12):4976-4983. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
