| Cas No.: | 778274-97-8 |
| Chemical Name: | N-(2-Hydroxyethyl)-4-(6-(4-(trifluoromethoxy)phenylamino)pyrimidin-4-yl)benzamide |
| Synonyms: | N-(2-hydroxyethyl)-4-(6-(4-(trifluoromethoxy)phenylamino)pyrimidin-4-yl)benzamide;NULL;N-(2-Hydroxyethyl)-4-(6-((4-(trifluoromethoxy)phenyl)amino)pyrimidin-4-yl)benzamide;N-(2-hydroxyethyl)-4-(6-{[4-(trifluoromethoxy)phenyl]amino}pyrimidin-4-yl)benzamide;MDK74978Multi-kinase inhibitor;N-(2-hydroxyethyl)-4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
| SMILES: | FC(OC1C([H])=C([H])C(=C([H])C=1[H])N([H])C1C([H])=C(C2C([H])=C([H])C(C(N([H])C([H])([H])C([H])([H])O[H])=O)=C([H])C=2[H])N=C([H])N=1)(F)F |
| Formula: | C20N4O3F3H17 |
| M.Wt: | 418.3692 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Multi-kinase inhibitor 1 is a potent multi-kinase inhibitor. Multi-kinase inhibitor 1 has the potential for diseases or disorders associated with abnormal or deregulated tyrosine kinase activity, particularly diseases associated with the activity of PDGF-R, c-Kit and Bcr-abl[1]. |
| In Vitro: | Multi-kinase inhibitor 1 (compound 68) is a potent multi-kinase inhibitor. The protein kinases represent a large family of proteins, which play a central role in the regulation of a wide variety of cellular processes and maintaining control over cellular function. These kinases include receptor tyrosine kinases, such as platelet derived growth factor receptor kinase(PDGF-R), the receptor kinase for stem cell factor, c-Kit, and non-receptor tyrosine kinases, such as the fusion kinase Bcr-abl[1]. |
| References: | [1]. Qiang Ding, et al. Novel compounds and compositions as protein kinase inhibitors. WO2004089286A2. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
