| Cas No.: | 1922153-17-0 |
| Chemical Name: | 1-Methyl-4-[4-(4-{3-[(Piperidin-4-Yl)methoxy]pyridin-4-Yl}-1h-Pyrazol-1-Yl)phenyl]piperazine |
| Synonyms: | MELK-8a;1-Methyl-4-[4-(4-{3-[(Piperidin-4-Yl)methoxy]pyridin-4-Yl}-1h-Pyrazol-1-Yl)phenyl]piperazine;MELK-8a hydrochloride?;BCP20820;BDBM50185433;MELK 8a hydrochloride?;MELK-8a HCl;Q27456307;1-methyl-4-[4-[4-[3-(piperidin-4-ylmethoxy)pyridin-4-yl]pyrazol-1-yl]phenyl]piperazine;6BF |
| SMILES: | O(C1C=NC=CC=1C1C=NN(C=1)C1C=CC(=CC=1)N1CCN(C)CC1)CC1CCNCC1 |
| Formula: | C25H32N6O |
| M.Wt: | 432.56 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
