| Cas No.: | 2375070-79-2 |
| Chemical Name: | MS48107 |
| Synonyms: | MS48107;MS 48107;MS-48107; (2-(4-Amino-6-((4-phenoxybenzyl)amino)-1,3,5-triazin-2-yl)-3-fluorophenyl)methanol |
| SMILES: | FC1=C([H])C([H])=C([H])C(C([H])([H])O[H])=C1C1=NC(N([H])[H])=NC(=N1)N([H])C([H])([H])C1C([H])=C([H])C(=C([H])C=1[H])OC1C([H])=C([H])C([H])=C([H])C=1[H] |
| Formula: | C23H20FN5O2 |
| M.Wt: | 417.4356 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
