| Cas No.: | 2095625-97-9 |
| Chemical Name: | Milademetan tosylate hydrate |
| SMILES: | CC1=CC=C(S(=O)(O)=O)C=C1.O=C2NC3=CC(Cl)=CC=C3[C@]24C5(N[C@H]([C@@H]4C6=CC=NC(Cl)=C6F)C(N[C@@H]7CC[C@H](OC7)C(N)=O)=O)CCC(C)(CC5)C.[H]O[H] |
| Formula: | C37H44Cl2FN5O8S |
| M.Wt: | 808.74 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
