| Cas No.: | 224624-80-0 |
| Chemical Name: | D-Proline,1,1'-(1,6-dioxo-1,6-hexanediyl)bis- |
| Synonyms: | D-Proline,1,1'-(1,6-dioxo-1,6-hexanediyl)bis-;(2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxohexanoyl]pyrrolidine-2-carboxylic acid;CPHPC;(2R,2'R)-1,1'-(1,6-dioxohexane-1,6-diyl)dipyrrolidine-2-carboxylic acid (non-preferred name);Ro-63-8695;Miridesap |
| SMILES: | O=C(N1[C@H](CCC1)C(O)=O)CCCCC(N2[C@H](CCC2)C(O)=O)=O |
| Formula: | C16H24N2O6 |
| M.Wt: | 340.37156 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Miridesap is a ligand for serum amyloid P component (SAP) and intends to inhibit and dissociate SAP binding to amyloid fibrils and tangles. |
| In Vitro: | Miridesap is a ligand for serum amyloid P component (SAP) and intends to inhibit and dissociate SAP binding to amyloid fibrils and tangles[1]. Miridesap depletes circulating SAP almost completely but leaves some SAP in amyloid deposits for specific recognition by subsequently administered therapeutic anti-SAP antibodies[2]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
