| Cas No.: | 1260075-17-9 |
| Chemical Name: | N-(4-(4-(cyclopropylmethyl)piperazine-1-carbonyl)phenyl)quinoline-8-sulfonamide |
| Synonyms: | N-(4-(4-(cyclopropylmethyl)piperazine-1-carbonyl)phenyl)quinoline-8-sulfonamide |
| SMILES: | O=S(=O)(NC1C=CC(C(=O)N2CCN(CC3CC3)CC2)=CC=1)C1C=CC=C2C=1N=CC=C2 |
| Formula: | C24H26N4O3S |
| M.Wt: | 450.553244113922 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Mitapivat is a potent human R-type pyruvate kinase (PKR) inhibitor; also shows potency for mutant PKR including R510Q PKR, R532W PKR, T384W PKR etc. |
| References: | [1]. PYRUVATE KINASE ACTIVATORS FOR USE IN THERAPY. Patent WO/2012/151451A1 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
