| Cas No.: | 1261289-04-6 |
| Chemical Name: | O-304,0 304 |
| Synonyms: | O-304,0 304 |
| SMILES: | C1=CC(Cl)=CC=C1CN1C(=O)N=C(NC(=O)C2=CC=C(Cl)C=C2)S1 |
| Formula: | C16H11Cl2N3O2S |
| M.Wt: | 378.99 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | O-304 is a small molecule AMPK activator. |
| In Vivo: | O-304 efficiently increases glucose uptake and reduces insulin resistance in skeletal muscle a primary cause of obesity-induced T2D. O-304 also reverses β-cell stress/dysfunction and induce β-cell rest. O-304 also increases energy expenditure and protects against diet induced obesity, fatty liver, hyperlipidemia and diabetes. CVD remains a major cause of death of T2 diabetics, and O-304 increases peripheral blood flow and left ventricular function, and acts as an “Exercise mimetic”. Thus, as an AMPK activator O-304 uniquely mitigates many of the metabolic and cardiovascular complications associated with the obesity epidemic. O-304 has the unique potential to increase glucose uptake and reduce insulin resistance in newly diagnosed T2 diabetics and as such prevent the associated β-cell hyperactivity/failure and progression of the disease[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
