| Cas No.: | 300586-90-7 |
| Chemical Name: | N-1H-pyrrolo[2,3-c]pyridin-5-yl- |
| Synonyms: | OAC1,OAC-1,OAC 1 |
| SMILES: | C(NC1N=CC2NC=CC=2C=1)(=O)C1=CC=CC=C1 |
| Formula: | C14H11N3O |
| M.Wt: | 237.26 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | OAC1 is a Octamer-binding transcription factor 4 (Oct4)-activating compound; enhances the iPSC reprogramming efficiency and accelerated the reprogramming process. |
| In Vitro: | OAC1 enhances the formation of Oct4-GFP+ colonies and accelerates the dynamics of reprogramming. OAC1 enhanced reprogramming efficiency through a mechanism that is independent of endogenous Oct4 promoter demethylation. OAC1 enhanced reprogramming efficiency through a mechanism that is distinct from suppressing p53-p21 expression. Luciferase assay revealed that OAC1 had no effect on Topflash activity, although BIO activated the Topflash reporter potently. OAC1 functions through a mechanism that is independent of the Wnt signaling. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
