| Cas No.: | 1235403-62-9 |
| Chemical Name: | PF-05089771 |
| Synonyms: | PF 05089771,PF-05089771,PF05089771 |
| SMILES: | O=S(C1=CC(Cl)=C(OC2=CC=C(Cl)C=C2C3=C(N)NN=C3)C=C1F)(NC4=CSC=N4)=O |
| Formula: | C18H12Cl2FN5O3S2 |
| M.Wt: | 500.344 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | PF 05089771 is a Nav1.7 channel blocker extracted from patent WO/2010/079443 A1, compound example 788, has an IC50 of 8.6 nM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
