| Cas No.: | 2765218-56-0 |
| Chemical Name: | PY-60 |
| Synonyms: | PY60, PY 60 |
| SMILES: | O=C(C1=NOC(C2=CC=CC=C2)=C1)NCCCC3=NC=CS3 |
| Formula: | C16H15N3O2S |
| M.Wt: | 313.37 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Shalhout SZ, et al. YAP-dependent proliferation by a small molecule targeting annexin A2. Nat Chem Biol. 2021;17(7):767-775. |
| Description: | PY-60 is a novel activator of YAP-dependent gene expression.It targets ANXA2 in the Hippo pathway. |
| References: | 1. Shalhout SZ, et al. Nat Chem Biol. 2021 Jul;17(7):767-775. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
