| Cas No.: | 102625-70-7 |
| SMILES: | O=S(C1=NC2=CC=C(OC(F)F)C=C2N1)CC3=NC=CC(OC)=C3OC |
| Formula: | C16H15F2N3O4S |
| M.Wt: | 383.37 |
| Purity: | >98% |
| Description: | Pantoprazole is a proton pump inhibitor used for short-term treatment of erosion and ulceration of the esophagus caused by gastroesophageal reflux disease. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
