| Cas No.: | 1417162-36-7 |
| Chemical Name: | RI2,RI 2 |
| Synonyms: | RI2,RI 2 |
| SMILES: | COC1=CC=C(C=C1)C2=C(C(=O)N(C2=O)C3=CC(=C(C=C3)Cl)Cl)N4CCOCC4 |
| Formula: | C21H18Cl2N2O4 |
| M.Wt: | 433.28 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | RI-2 is a reversible RAD51 inhibitor, with an IC50 of 44.17 μM, and specifically inhibits homologous recombination repair in human cells. |
| In Vitro: | RI-2 (7a) is a reversible RAD51 inhibitor, with an IC50 of 44.17 μM. RI-2 specifically inhibits homologous recombination repair in human cells. RI-2 (150 μM) induces a significant sensitization of cells[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
