| Cas No.: | 1303533-81-4 |
| Chemical Name: | methyl N-[(2S)-1-{(2S)-2-[5-(6-{2-[(2S)-1-{(2S)-2-[(methoxycarbonyl)amino]-3-methylbutanoyl}pyrrolidin-2-yl]-1H-imidazol-4-yl}naphthalen-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl}-3-methyl-1-oxobutan-2-yl]carbamate dihydrochloride |
| Synonyms: | PPI-668; PPI 668; PPI668; ASC16; ASC-16; ASC 16; BI238630; C5; Ravidasvir dihydrochloride |
| SMILES: | O=C(OC)N[C@@H](C(C)C)C(N1[C@H](C2=NC3=CC(C4=CC=C5C=C(C6=CNC([C@H]7N(C([C@@H](NC(OC)=O)C(C)C)=O)CCC7)=N6)C=CC5=C4)=CC=C3N2)CCC1)=O.[H]Cl.[H]Cl |
| Formula: | C42H52Cl2N8O6 |
| M.Wt: | 835.828 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Ravidasvir, also known as PPI-668 and ASC16, is a second-generation, orally active, potent and selective HCV NS5A protein inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
