| Cas No.: | 1062609-99-7 |
| Chemical Name: | S-(+)-O-Desmethyl-Venlafaxine-d6 |
| Synonyms: | S-(+)-O-DesMethyl-Venlafaxine-d6 |
| SMILES: | [C@@H](C1C=CC(O)=CC=1)(C1(CCCCC1)O)CN(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Formula: | C16H19D6NO2 |
| M.Wt: | 269.412 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
