| Cas No.: | 2101315-36-8 |
| Chemical Name: | [(1R,2S,5R)-5-Methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)acetate;hydrochloride |
| Synonyms: | s8828;[(1R,2S,5R)-5-Methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-3-methylbenzimidazol-3-ium-1-yl)acetate;hyd;Gboxin |
| SMILES: | Cl[H].O(C(C([H])([H])N1C2=C([H])C([H])=C([H])C([H])=C2[N+](C([H])([H])[H])=C1C([H])([H])C([H])([H])[H])=O)[C@]1([H])C([H])([H])[C@]([H])(C([H])([H])[H])C([H])([H])C([H])([H])[C@@]1([H])C([H])(C([H])([H])[H])C([H])([H])[H] |
| Formula: | C22H34ClN2O2 |
| M.Wt: | 393.9706 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Gboxin is an oxidative phosphorylation inhibitor targets glioblastoma. Gboxin inhibits the activity of F0F1 ATP synthase[1]. Antitumour activity[1]. |
| References: | [1]. Shi Y, et al. Gboxin is an oxidative phosphorylation inhibitor that targets glioblastoma. Nature. 2019 Mar;567(7748):341-346. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
