| Cas No.: | 475650-36-3 |
| Chemical Name: | Inarigivir |
| Synonyms: | 1-[4-[[5-(6-Aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl]oxy-5-(hydroxymethy;ORI-9020;SB-9000;2’-O-Methyl-P-thiouridylyl-(3’→5’)-2’-deoxyadenosine;Inarigivir |
| SMILES: | S=P(O[H])(OC([H])([H])C1([H])C([H])(C([H])([H])C([H])(N2C([H])=NC3=C(N([H])[H])N=C([H])N=C23)O1)O[H])OC1([H])C([H])(C([H])([H])O[H])OC([H])(C1([H])OC([H])([H])[H])N1C([H])=C([H])C(N([H])C1=O)=O |
| Formula: | C20N7O10PSH26 |
| M.Wt: | 587.5001 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Inarigivir (ORI-9020;SB-9000) is a dinucleotide which can significantly reduce liver HBV DNA in transgenic mice expressing hepatitis B virus. |
| In Vivo: | I.p. injection of Inarigivir at 100 mg/kg/day significantly reduces viral DNA in the liver and shows anti-HBV activity similar ADV positive control. Serum HBV DNA is not reduced in response to treatment. Inarigivir does not affect levels of HBV RNA in liver, levels of HBeAg in serum, or mean titers of HBsAg. The minimal effective dose is identified to be between 1.6 and 0.5 mg/kg/day using liver HBV DNA values[1]. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
