| Cas No.: | 300561-58-4 |
| Synonyms: | SKF 77434,SKF-77434,SKF77434 |
| SMILES: | Br.OC1=CC2=C(C=C1O)C(CN(CC=C)CC2)C1=CC=CC=C1 |
| Formula: | C19H21NO2.HBr |
| M.Wt: | 376.29 |
| Description: | Selective dopamine D1-like receptor partial agonist (IC50 values are 19.7 and 2425 nM for binding to D1-like and D2-like receptors respectively). Centrally active following systemic administration in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
