| Cas No.: | 1597426-53-3 |
| Chemical Name: | 3-((1S,2R)-2-(cyclobutylamino)cyclopropyl)-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide fumarate |
| Synonyms: | T448;T 448 |
| SMILES: | C(NC1=NN=C(C)S1)(=O)C1=CC=CC([C@H]2C[C@@H]2NC2CCC2)=C1.C(O)(=O)/C=C/C(O)=O |
| Formula: | C21H24N4O5S |
| M.Wt: | 444.506 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | T-448 (T448) is a specific inhibitor of LSD1 enzyme activity, enhances H3K4 methylation in primary cultured rat neurons but has little impact on LSD1-GFI1B complex in human TF-1a erythroblasts; increases brain H3K4 methylation and partially restored learning function in mice with NMDA receptor hypofunction, shows unique therapeutic approaches for central nervous system disorders associated with epigenetic dysregulation. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
