| Cas No.: | 1858276-04-6 |
| Chemical Name: | [(1R,2S,4R)-4-[[5-[4-[(1R)-7-Chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| Synonyms: | TAK-981;TAK 981;TAK981 |
| SMILES: | ClC1C([H])=C([H])C2C([H])([H])C([H])([H])N([H])[C@@]([H])(C3=C(C([H])([H])[H])SC(=C3[H])C(C3=C([H])N=C([H])N=C3N([H])[C@@]3([H])C([H])([H])[C@@]([H])([C@@]([H])(C([H])([H])OS(N([H])[H])(=O)=O)C3([H])[H])O[H])=O)C=2C=1[H] |
| Formula: | C25H28ClN5O5S2 |
| M.Wt: | 578.103322029114 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Sumoylation inhibitor TAK-981. |
| Description: | TAK-981 is a first in class and selective inhibitor of the SUMOylation enzymatic cascade, with potential immune-activating and antineoplastic activities[1][2]. |
| Target: | SUMOylation[1]. |
| In Vivo: | A single sub-cutaneous injection of TAK-981 in naive Balb/c mice at the brachial lymph nodes induces activation of DCs[2]. |
| In Vitro: | TAK-981 is able to increase the production of type 1 interferon (IFN), thereby increasing type 1 IFN-mediated signaling, activating innate effector cells and enhancing the antitumor innate immune responses[1]. |
| References: | [1]. Sumoylation inhibitor TAK-981. [2]. TAK-981. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
