| Cas No.: | 1002801-51-5 |
| Chemical Name: | TH10785 |
| Synonyms: | 4-Quinazolinamine, N-cyclohexyl-2-cyclopropyl-;TH10785 |
| SMILES: | N1=C2C(C=CC=C2)=C(NC2CCCCC2)N=C1C1CC1 |
| Formula: | C17H21N3 |
| M.Wt: | 267.37 |
| Purity: | >98% |
| Sotrage: | -20 |
| Publication: | Small-molecule activation of OGG1 increases oxidative DNA damage repair by gaining a new function-Science, 376 (6600), ?DOI: 10.1126/science.abf8980 |
| Description: | TH10785 is a small-molecule activator that binds to the active site of 8-oxo guanine DNA glycosylase 1 (OGG1) and enables the protein to completely cleave the damaged DNA strand, which results in an overall increased repair of oxidative DNA damage. |
| References: | Small-molecule activation of OGG1 increases oxidative DNA damage repair by gaining a new function-Science, 376 (6600), ?DOI: 10.1126/science.abf8980 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
