| Cas No.: | 57333-96-7 |
| Chemical Name: | Tacalcitol |
| Synonyms: | Tacalcitol;(1a,3b,5Z,7E,24R)-9,10-Secocholesta-5,7,10(19)-triene-1,3,24-triol;(1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol;1,24-dihydroxy Vitamin D3;1,24(R)-Dihydroxyvitamin D3;1,24R-dihydroxyvitamin D3;1.alpha.,24R-Dihydroxyvitamin D3;Bonalfa;Curatoderm;TV-02;TV-02H;(1α,3β,5Z,7E,24R)-9,10-secocholesta-5,7,10(19)-triene-1,3,24-triol;1α,24R-dihydroxycholecalciferol;1α,24R-dihydroxyvitamin D3 |
| SMILES: | C=C1[C@@H](O)C[C@H](O)C/C1=C/C=C2[C@H]3[C@]([C@@H]([C@H](C)CC[C@@H](O)C(C)C)CC3)(C)CCC/2 |
| Formula: | C27H44O3 |
| M.Wt: | 416.636468887329 |
| Purity: | >99% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | For the detailed information of Tacalcitol, the solubility of Tacalcitol in water, the solubility of Tacalcitol in DMSO, the solubility of Tacalcitol in PBS buffer, the animal experiment(test) (test) of Tacalcitol, the cell expriment (test) of Tacalcitol |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
