| Cas No.: | 150080-09-4 |
| Chemical Name: | (R)-1-((S)-2-amino-3-methylbutanoyl)pyrrolidin-2-ylboronic acid methanesulfonic acid (1:1) |
| Synonyms: | BXCL701; BXCL 701; BXCL-701; PT-100, PT100, PT 100, D05989, Val-boro-pro, Talabostat |
| SMILES: | NC(C(C)C)C(N1CCCC1B(O)O)=O.CS(O)(=O)=O |
| Formula: | C10H23BN2O6S |
| M.Wt: | 310.17 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Talabostat mesilate(PT-100; Val-boroPro) is an orally active, specific inhibitor of dipeptidyl peptidases(IC50=1 nM for DPP4), including tumor-associated fibroblast activation protein.By cleaving N-terminal Xaa-Pro or Xaa-Ala residues, talabostat inhibits dipeptidyl peptidases, such as fibroblast activation protein (FAP), resulting in the stimulation of cytokine and chemokine production and specific T-cell immunity and T-cell- dependent activity. This agent may also stimulate the production of colony stimulating factors, such as granulocyte colony stimulating factor (G-CSF), resulting in the stimulation of hematopoiesis. Dipeptidyl peptidases are involved in the activation of polypeptide hormones and chemokines. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
