| Cas No.: | 69004-15-5 |
| Chemical Name: | 1-Methyl-3-{3-methyl-4-[4-(trifluormethylsulfinyl)-phenoxy]-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion |
| Synonyms: | 1-Methyl-3-{3-methyl-4-[4-(trifluormethylsulfinyl)-phenoxy]-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion;(+/-)-TOLTRAZURIL SULFOXIDE;1-methyl-3-[3-methyl-4-[4-(trifluoromethylsulfinyl)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione;rac Toltrazuril Sulf;rac Toltrazuril Sulfoxide;Toltrazuril sulfoxide;toltrazuril |
| SMILES: | CC1=CC(N2C(NC(N(C2=O)C)=O)=O)=CC=C1OC3=CC=C(S(C(F)(F)F)=O)C=C3 |
| Formula: | C18H14F3N3O5S |
| M.Wt: | 441.38100 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
