| Cas No.: | 763-10-0 |
| Chemical Name: | Diphosphoric acid,P-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]- |
| Synonyms: | Diphosphoric acid,P-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-;(2E)-3,7-Dimethyl-2,6-octadien-1-yl trihydrogen diphosphate;GERANYL DIPHOSPHATE (GPP);2,6-Octadiene,1-azido-3,7-dimethyl-,(2E);geraniol pyrophosphate;geranyl azide;Geranyl diphosphate;geranylpyrophosphate;trans-3,7-Dimethyl-2,6-octadienyl pyrophosphate;GPP |
| SMILES: | C/C(=C/CC/C(=C/COP(OP(=O)(O)O)(O)=O)/C)/C |
| Formula: | C10H20O7P2 |
| M.Wt: | 314.2092 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
