| Cas No.: | 697797-51-6 |
| Chemical Name: | (2S)-2-Amino-4-[[(4-chlorophenyl)methyl]amino]-1-(1-piperidinyl)-1-butanone dihydrochloride |
| Synonyms: | UAMC 00039,UAMC-00039 |
| SMILES: | ClC1=CC=C(CNCC[C@H](N)C(N2CCCCC2)=O)C=C1.Cl.Cl |
| Formula: | C16H24ClN3O.2HCl |
| M.Wt: | 382.76 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | UAMC00039 dihydrochloride is a potent inhibitor of dipeptidyl peptidase II (DPP-II) (IC50 = 0.48 nM). UAMC00039 exhibits selectivity for DPP-II against DPP-9, DPP-8 and DPP-IV (IC50 values are 78.6, 142 and 165 μM, respectively). Orally available. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
