| Cas No.: | 942142-51-0 |
| Chemical Name: | VTP27999; VTP 27999 |
| Synonyms: | VTP27999; VTP 27999 |
| SMILES: | O=C(N1CCC[C@@H]([C@@H](OCCNC(OC)=O)C2=CC=CC(Cl)=C2)C1)NC[C@@H](NC)C[C@@H]3COCCC3 |
| Formula: | C26H41ClN4O5 |
| M.Wt: | 525.08 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | VTP-27999 is an alkyl amine Renin inhibitor; VTP-27999 is useful for Hypertension and End-Organ Diseases. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
